C39H25N3 — CID 176831337
2-phenyl-4-(4-phenylphenyl)-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)-1,3,5-triazine (PubChem CID 176831337) has the molecular formula C39H25N3 and a molecular weight of 546.72 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176831337 |
| Molecular Formula | C39H25N3 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1c1c([2H])c(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccccc5)cc4)n3)c([2H])c([2H])c21 |
| InChI | InChI=1S/C39H25N3/c1-3-11-26(12-4-1)27-19-21-29(22-20-27)38-40-37(28-13-5-2-6-14-28)41-39(42-38)30-23-24-35-33-17-8-7-15-31(33)32-16-9-10-18-34(32)36(35)25-30/h1-25H/i7D,8D,9D,10D,15D,16D,17D,18D,23D,24D,25D |
| InChIKey | JFPDLGLXRADCIW-PJAQARJOSA-N |
| XLogP | 10.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|