C45H30N4 — CID 171420324
1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 171420324) has the molecular formula C45H30N4 and a molecular weight of 638.84 g/mol. Its IUPAC name is 1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 171420324 |
| Molecular Formula | C45H30N4 |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 638.32 |
| IUPAC Name | 1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c3c(c2[2H])c2c([2H])c([2H])c([2H])c([2H])c2n3-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccccc5)cc4)n3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H30N4/c1-4-12-31(13-5-1)33-20-22-35(23-21-33)44-46-43(34-16-8-3-9-17-34)47-45(48-44)36-24-27-38(28-25-36)49-41-19-11-10-18-39(41)40-30-37(26-29-42(40)49)32-14-6-2-7-15-32/h1-30H/i2D,6D,7D,10D,11D,14D,15D,18D,19D,26D,29D,30D |
| InChIKey | XIPHWWBLFFUEPJ-FNTFKFHQSA-N |
| XLogP | 11.30 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |