C51H34N4 — CID 172519979
1,2,3,4,5,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-6-[4-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]carbazole (PubChem CID 172519979) has the molecular formula C51H34N4 and a molecular weight of 714.93 g/mol. Its IUPAC name is 1,2,3,4,5,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-6-[4-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]carbazole.
| Compound Name | 1,2,3,4,5,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-6-[4-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 172519979 |
| Molecular Formula | C51H34N4 |
| Molecular Weight | 714.93 g/mol |
| Exact Mass | 714.35 |
| IUPAC Name | 1,2,3,4,5,7,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-6-[4-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c(-c4ccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccc(-c8ccccc8)cc7)n6)c5)cc4)c([2H])c([2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C51H34N4/c1-4-13-35(14-5-1)36-27-29-40(30-28-36)50-52-49(39-15-6-2-7-16-39)53-51(54-50)43-18-12-17-41(33-43)37-23-25-38(26-24-37)42-31-32-48-46(34-42)45-21-10-11-22-47(45)55(48)44-19-8-3-9-20-44/h1-34H/i3D,8D,9D,10D,11D,19D,20D,21D,22D,31D,32D,34D |
| InChIKey | DHIPNBZQZIFWLL-HPSWUETCSA-N |
| XLogP | 12.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.93 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |