C33H21N3 — CID 176831351
2-(2,3,4,5,6-pentadeuteriophenyl)-4-phenyl-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)-1,3,5-triazine (PubChem CID 176831351) has the molecular formula C33H21N3 and a molecular weight of 475.65 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentadeuteriophenyl)-4-phenyl-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)-1,3,5-triazine.
| Compound Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-4-phenyl-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176831351 |
| Molecular Formula | C33H21N3 |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-4-phenyl-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3c([2H])c([2H])c4c5c([2H])c([2H])c([2H])c([2H])c5c5c([2H])c([2H])c([2H])c([2H])c5c4c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C33H21N3/c1-3-11-22(12-4-1)31-34-32(23-13-5-2-6-14-23)36-33(35-31)24-19-20-29-27-17-8-7-15-25(27)26-16-9-10-18-28(26)30(29)21-24/h1-21H/i1D,3D,4D,7D,8D,9D,10D,11D,12D,15D,16D,17D,18D,19D,20D,21D |
| InChIKey | QOJIRRILUBSFFD-NVEQWJBASA-N |
| XLogP | 8.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|