C22H15ClN2O — CID 13327262
2-chloro-5-phenoxy-4,6-diphenylpyrimidine (PubChem CID 13327262) has the molecular formula C22H15ClN2O and a molecular weight of 358.83 g/mol. Its IUPAC name is 2-chloro-5-phenoxy-4,6-diphenylpyrimidine.
| Compound Name | 2-chloro-5-phenoxy-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 13327262 |
| Molecular Formula | C22H15ClN2O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-chloro-5-phenoxy-4,6-diphenylpyrimidine |
| SMILES | Clc1nc(-c2ccccc2)c(Oc2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H15ClN2O/c23-22-24-19(16-10-4-1-5-11-16)21(26-18-14-8-3-9-15-18)20(25-22)17-12-6-2-7-13-17/h1-15H |
| InChIKey | WFBWWINKQMHXHA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |