C84H54N6O6 — CID 86035796
4,5,10,11,16,17-hexakis(4-phenoxyphenyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene (PubChem CID 86035796) has the molecular formula C84H54N6O6 and a molecular weight of 1243.39 g/mol. Its IUPAC name is 4,5,10,11,16,17-hexakis(4-phenoxyphenyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene.
| Compound Name | 4,5,10,11,16,17-hexakis(4-phenoxyphenyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 86035796 |
| Molecular Formula | C84H54N6O6 |
| Molecular Weight | 1243.39 g/mol |
| Exact Mass | 1242.41 |
| IUPAC Name | 4,5,10,11,16,17-hexakis(4-phenoxyphenyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene |
| SMILES | c1ccc(Oc2ccc(-c3nc4c5nc(-c6ccc(Oc7ccccc7)cc6)c(-c6ccc(Oc7ccccc7)cc6)nc5c5nc(-c6ccc(Oc7ccccc7)cc6)c(-c6ccc(Oc7ccccc7)cc6)nc5c4nc3-c3ccc(Oc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C84H54N6O6/c1-7-19-61(20-8-1)91-67-43-31-55(32-44-67)73-74(56-33-45-68(46-34-56)92-62-21-9-2-10-22-62)86-80-79(85-73)81-83(89-76(58-37-49-70(50-38-58)94-64-25-13-4-14-26-64)75(87-81)57-35-47-69(48-36-57)93-63-23-11-3-12-24-63)84-82(80)88-77(59-39-51-71(52-40-59)95-65-27-15-5-16-28-65)78(90-84)60-41-53-72(54-42-60)96-66-29-17-6-18-30-66/h1-54H |
| InChIKey | FEKVBPARAQTDIA-UHFFFAOYSA-N |
| XLogP | 22.27 |
| TPSA | 132.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1243.39 |
| LogP ≤ 5 | 22.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|