C26H17ClN2 — CID 118545869
2-chloro-4-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]quinazoline (PubChem CID 118545869) has the molecular formula C26H17ClN2 and a molecular weight of 397.92 g/mol. Its IUPAC name is 2-chloro-4-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]quinazoline.
| Compound Name | 2-chloro-4-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]quinazoline |
|---|---|
| PubChem CID | 118545869 |
| Molecular Formula | C26H17ClN2 |
| Molecular Weight | 397.92 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-chloro-4-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]quinazoline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3ccc(-c4nc(Cl)nc5ccccc45)cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C26H17ClN2/c27-26-28-24-9-5-4-8-23(24)25(29-26)22-16-14-21(15-17-22)20-12-10-19(11-13-20)18-6-2-1-3-7-18/h1-17H/i1D,2D,3D,6D,7D |
| InChIKey | OQRZLPVTTWECIP-FSTBWYLISA-N |
| XLogP | 7.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.92 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |