C42H24O — CID 171045031
4-naphthalen-1-yl-12-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene (PubChem CID 171045031) has the molecular formula C42H24O and a molecular weight of 553.71 g/mol. Its IUPAC name is 4-naphthalen-1-yl-12-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene.
| Compound Name | 4-naphthalen-1-yl-12-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 171045031 |
| Molecular Formula | C42H24O |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 4-naphthalen-1-yl-12-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
| SMILES | [2H]c1c([2H])c2c([2H])c([2H])c3c([2H])c([2H])c(-c4ccc5c6c(cccc46)-c4cc(-c6cccc7ccccc67)ccc4O5)c4c([2H])c([2H])c(c1[2H])c2c34 |
| InChI | InChI=1S/C42H24O/c1-2-10-30-25(6-1)7-4-11-31(30)29-18-22-38-37(24-29)35-13-5-12-34-33(21-23-39(43-38)42(34)35)32-19-16-28-15-14-26-8-3-9-27-17-20-36(32)41(28)40(26)27/h1-24H/i3D,8D,9D,14D,15D,16D,17D,19D,20D |
| InChIKey | GBZZOKDCEUMBCW-WYYFLCOGSA-N |
| XLogP | 12.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|