C48H30 — CID 170778694
1,2,4,5,6,7,9,10-octadeuterio-3,8-bis(3-naphthalen-1-ylphenyl)pyrene (PubChem CID 170778694) has the molecular formula C48H30 and a molecular weight of 614.82 g/mol. Its IUPAC name is 1,2,4,5,6,7,9,10-octadeuterio-3,8-bis(3-naphthalen-1-ylphenyl)pyrene.
| Compound Name | 1,2,4,5,6,7,9,10-octadeuterio-3,8-bis(3-naphthalen-1-ylphenyl)pyrene |
|---|---|
| PubChem CID | 170778694 |
| Molecular Formula | C48H30 |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | 1,2,4,5,6,7,9,10-octadeuterio-3,8-bis(3-naphthalen-1-ylphenyl)pyrene |
| SMILES | [2H]c1c([2H])c2c([2H])c([2H])c3c(-c4cccc(-c5cccc6ccccc56)c4)c([2H])c([2H])c4c([2H])c([2H])c(c1-c1cccc(-c5cccc6ccccc56)c1)c2c43 |
| InChI | InChI=1S/C48H30/c1-3-17-39-31(9-1)11-7-19-41(39)35-13-5-15-37(29-35)43-25-21-33-24-28-46-44(26-22-34-23-27-45(43)47(33)48(34)46)38-16-6-14-36(30-38)42-20-8-12-32-10-2-4-18-40(32)42/h1-30H/i21D,22D,23D,24D,25D,26D,27D,28D |
| InChIKey | DBGISKAJDDNLPO-ROKZGSKTSA-N |
| XLogP | 13.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|