C48H28 — CID 166019836
1,2,3,4,5,6,7,9,10-nonadeuterio-8-[2-naphthalen-1-yl-5-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]pyrene (PubChem CID 166019836) has the molecular formula C48H28 and a molecular weight of 622.86 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,9,10-nonadeuterio-8-[2-naphthalen-1-yl-5-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]pyrene.
| Compound Name | 1,2,3,4,5,6,7,9,10-nonadeuterio-8-[2-naphthalen-1-yl-5-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]pyrene |
|---|---|
| PubChem CID | 166019836 |
| Molecular Formula | C48H28 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 1,2,3,4,5,6,7,9,10-nonadeuterio-8-[2-naphthalen-1-yl-5-(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl)phenyl]pyrene |
| SMILES | [2H]c1c([2H])c2c([2H])c([2H])c3c([2H])c([2H])c(-c4ccc(-c5cccc6ccccc56)c(-c5c([2H])c([2H])c6c([2H])c([2H])c7c([2H])c([2H])c([2H])c8c([2H])c([2H])c5c6c78)c4)c4c([2H])c([2H])c(c1[2H])c2c34 |
| InChI | InChI=1S/C48H28/c1-2-12-37-29(6-1)7-5-13-39(37)40-25-22-36(38-23-18-34-16-14-30-8-3-10-32-20-26-42(38)47(34)45(30)32)28-44(40)41-24-19-35-17-15-31-9-4-11-33-21-27-43(41)48(35)46(31)33/h1-28H/i3D,4D,8D,9D,10D,11D,14D,15D,16D,17D,18D,19D,20D,21D,23D,24D,26D,27D |
| InChIKey | PIDHGOGOHVEVTA-SBMRCBNQSA-N |
| XLogP | 13.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|