C22H23N — CID 166503070
2,3,5-trideuterio-4-[2,3,5,6-tetradeuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-6-(2,3,4,5-tetradeuteriophenyl)pyridine (PubChem CID 166503070) has the molecular formula C22H23N and a molecular weight of 314.51 g/mol. Its IUPAC name is 2,3,5-trideuterio-4-[2,3,5,6-tetradeuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-6-(2,3,4,5-tetradeuteriophenyl)pyridine.
| Compound Name | 2,3,5-trideuterio-4-[2,3,5,6-tetradeuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-6-(2,3,4,5-tetradeuteriophenyl)pyridine |
|---|---|
| PubChem CID | 166503070 |
| Molecular Formula | C22H23N |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 2,3,5-trideuterio-4-[2,3,5,6-tetradeuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-6-(2,3,4,5-tetradeuteriophenyl)pyridine |
| SMILES | [2H]c1cc(-c2nc([2H])c([2H])c(-c3c([2H])c([2H])c(C([2H])([2H])C(C)(C)C)c([2H])c3[2H])c2[2H])c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C22H23N/c1-22(2,3)16-17-9-11-18(12-10-17)20-13-14-23-21(15-20)19-7-5-4-6-8-19/h4-15H,16H2,1-3H3/i4D,5D,6D,7D,9D,10D,11D,12D,13D,14D,15D,16D2 |
| InChIKey | KBYCIZVBMXHUGQ-YMISCZHSSA-N |
| XLogP | 6.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |