C12H11BO3 — CID 171588911
[2,4,5-trideuterio-6-hydroxy-3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]boronic acid (PubChem CID 171588911) has the molecular formula C12H11BO3 and a molecular weight of 222.08 g/mol. Its IUPAC name is [2,4,5-trideuterio-6-hydroxy-3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]boronic acid.
| Compound Name | [2,4,5-trideuterio-6-hydroxy-3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 171588911 |
| Molecular Formula | C12H11BO3 |
| Molecular Weight | 222.08 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | [2,4,5-trideuterio-6-hydroxy-3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]boronic acid |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(O)c(B(O)O)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C12H11BO3/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,14-16H/i1D,2D,3D,4D,5D,6D,7D,8D |
| InChIKey | RIPJFTPXSYSECG-PGRXLJNUSA-N |
| XLogP | 0.74 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.08 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|