C36H27NO — CID 162782229
2,3,4,6-tetradeuterio-5-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anilino]phenyl]phenol (PubChem CID 162782229) has the molecular formula C36H27NO and a molecular weight of 503.70 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anilino]phenyl]phenol.
| Compound Name | 2,3,4,6-tetradeuterio-5-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anilino]phenyl]phenol |
|---|---|
| PubChem CID | 162782229 |
| Molecular Formula | C36H27NO |
| Molecular Weight | 503.70 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anilino]phenyl]phenol |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(N(c3ccc(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])cc3)c3ccc(-c4c([2H])c([2H])c([2H])c(O)c4[2H])cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C36H27NO/c38-36-13-7-12-32(26-36)31-18-24-35(25-19-31)37(33-20-14-29(15-21-33)27-8-3-1-4-9-27)34-22-16-30(17-23-34)28-10-5-2-6-11-28/h1-26,38H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,26D |
| InChIKey | ZELFOWKOAMTJFA-ISBRLDSUSA-N |
| XLogP | 9.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.70 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |