C30H23N — CID 89183809
2,3,4,5,6-pentadeuterio-N,N-bis(4-phenylphenyl)aniline (PubChem CID 89183809) has the molecular formula C30H23N and a molecular weight of 402.55 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-N,N-bis(4-phenylphenyl)aniline.
| Compound Name | 2,3,4,5,6-pentadeuterio-N,N-bis(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 89183809 |
| Molecular Formula | C30H23N |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-N,N-bis(4-phenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C30H23N/c1-4-10-24(11-5-1)26-16-20-29(21-17-26)31(28-14-8-3-9-15-28)30-22-18-27(19-23-30)25-12-6-2-7-13-25/h1-23H/i3D,8D,9D,14D,15D |
| InChIKey | VXKVZTGWNITVPY-CEBJTGGESA-N |
| XLogP | 8.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |