C54H40N2 — CID 121295016
2,3,4,5,6-pentadeuterio-N-[4-[3-[4-(N-(2,3,4,5,6-pentadeuteriophenyl)-4-phenylanilino)phenyl]phenyl]phenyl]-N-(4-phenylphenyl)aniline (PubChem CID 121295016) has the molecular formula C54H40N2 and a molecular weight of 726.99 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-N-[4-[3-[4-(N-(2,3,4,5,6-pentadeuteriophenyl)-4-phenylanilino)phenyl]phenyl]phenyl]-N-(4-phenylphenyl)aniline.
| Compound Name | 2,3,4,5,6-pentadeuterio-N-[4-[3-[4-(N-(2,3,4,5,6-pentadeuteriophenyl)-4-phenylanilino)phenyl]phenyl]phenyl]-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 121295016 |
| Molecular Formula | C54H40N2 |
| Molecular Weight | 726.99 g/mol |
| Exact Mass | 726.38 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-N-[4-[3-[4-(N-(2,3,4,5,6-pentadeuteriophenyl)-4-phenylanilino)phenyl]phenyl]phenyl]-N-(4-phenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3cccc(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5c([2H])c([2H])c([2H])c([2H])c5[2H])cc4)c3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C54H40N2/c1-5-14-41(15-6-1)43-24-32-51(33-25-43)55(49-20-9-3-10-21-49)53-36-28-45(29-37-53)47-18-13-19-48(40-47)46-30-38-54(39-31-46)56(50-22-11-4-12-23-50)52-34-26-44(27-35-52)42-16-7-2-8-17-42/h1-40H/i3D,4D,9D,10D,11D,12D,20D,21D,22D,23D |
| InChIKey | FZQCDTUCRVASQQ-CJZRWPSMSA-N |
| XLogP | 15.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.99 |
| LogP ≤ 5 | 15.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |