C34H25N — CID 171452094
2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-phenyl-N-(4-phenylphenyl)aniline (PubChem CID 171452094) has the molecular formula C34H25N and a molecular weight of 451.61 g/mol. Its IUPAC name is 2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-phenyl-N-(4-phenylphenyl)aniline.
| Compound Name | 2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-phenyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 171452094 |
| Molecular Formula | C34H25N |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-naphthalen-2-yl-N-phenyl-N-(4-phenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(-c2ccc3ccccc3c2)c([2H])c(N(c2ccccc2)c2ccc(-c3ccccc3)cc2)c1[2H] |
| InChI | InChI=1S/C34H25N/c1-3-10-26(11-4-1)28-20-22-33(23-21-28)35(32-15-5-2-6-16-32)34-17-9-14-30(25-34)31-19-18-27-12-7-8-13-29(27)24-31/h1-25H/i9D,14D,17D,25D |
| InChIKey | XAUKWFNEXKRPEA-GQLBZTKTSA-N |
| XLogP | 9.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |