C54H39N3S — CID 157193783
8-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-8-N-[3-(N-phenylanilino)phenyl]dibenzothiophene-2,8-diamine (PubChem CID 157193783) has the molecular formula C54H39N3S and a molecular weight of 767.02 g/mol. Its IUPAC name is 8-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-8-N-[3-(N-phenylanilino)phenyl]dibenzothiophene-2,8-diamine.
| Compound Name | 8-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-8-N-[3-(N-phenylanilino)phenyl]dibenzothiophene-2,8-diamine |
|---|---|
| PubChem CID | 157193783 |
| Molecular Formula | C54H39N3S |
| Molecular Weight | 767.02 g/mol |
| Exact Mass | 766.32 |
| IUPAC Name | 8-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2-N,2-N-diphenyl-8-N-[3-(N-phenylanilino)phenyl]dibenzothiophene-2,8-diamine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(N(c3cccc(N(c4ccccc4)c4ccccc4)c3)c3ccc4sc5ccc(N(c6ccccc6)c6ccccc6)cc5c4c3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C54H39N3S/c1-6-17-40(18-7-1)41-29-31-46(32-30-41)57(48-28-16-27-47(37-48)55(42-19-8-2-9-20-42)43-21-10-3-11-22-43)50-34-36-54-52(39-50)51-38-49(33-35-53(51)58-54)56(44-23-12-4-13-24-44)45-25-14-5-15-26-45/h1-39H/i1D,6D,7D,17D,18D |
| InChIKey | MRZFDDPKZJVTQA-QTTKOPGXSA-N |
| XLogP | 16.13 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.02 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |