C38H25NS — CID 177117007
N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-phenanthren-2-yldibenzothiophen-2-amine (PubChem CID 177117007) has the molecular formula C38H25NS and a molecular weight of 532.72 g/mol. Its IUPAC name is N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-phenanthren-2-yldibenzothiophen-2-amine.
| Compound Name | N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-phenanthren-2-yldibenzothiophen-2-amine |
|---|---|
| PubChem CID | 177117007 |
| Molecular Formula | C38H25NS |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-N-phenanthren-2-yldibenzothiophen-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(N(c3ccc4c(ccc5ccccc54)c3)c3ccc4sc5ccccc5c4c3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C38H25NS/c1-2-8-26(9-3-1)27-16-18-30(19-17-27)39(32-21-23-38-36(25-32)35-12-6-7-13-37(35)40-38)31-20-22-34-29(24-31)15-14-28-10-4-5-11-33(28)34/h1-25H/i1D,2D,3D,8D,9D |
| InChIKey | QPVTWTIVFUCRPC-NWCULCSXSA-N |
| XLogP | 11.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|