C20H18 — CID 158853164
1,2,3,4,5-pentadeuterio-6-[3-methyl-5-(2,3,4,6-tetradeuterio-5-methylphenyl)phenyl]benzene (PubChem CID 158853164) has the molecular formula C20H18 and a molecular weight of 267.42 g/mol. Its IUPAC name is 1,2,3,4,5-pentadeuterio-6-[3-methyl-5-(2,3,4,6-tetradeuterio-5-methylphenyl)phenyl]benzene.
| Compound Name | 1,2,3,4,5-pentadeuterio-6-[3-methyl-5-(2,3,4,6-tetradeuterio-5-methylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 158853164 |
| Molecular Formula | C20H18 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-[3-methyl-5-(2,3,4,6-tetradeuterio-5-methylphenyl)phenyl]benzene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(C)cc(-c3c([2H])c([2H])c([2H])c(C)c3[2H])c2)c([2H])c1[2H] |
| InChI | InChI=1S/C20H18/c1-15-7-6-10-18(11-15)20-13-16(2)12-19(14-20)17-8-4-3-5-9-17/h3-14H,1-2H3/i3D,4D,5D,6D,7D,8D,9D,10D,11D |
| InChIKey | CIMSNJATFVCLRX-MFPZSLDBSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |