C18H13BO2S — CID 172509567
[4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)phenyl]boronic acid (PubChem CID 172509567) has the molecular formula C18H13BO2S and a molecular weight of 311.22 g/mol. Its IUPAC name is [4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)phenyl]boronic acid.
| Compound Name | [4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 172509567 |
| Molecular Formula | C18H13BO2S |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | [4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)phenyl]boronic acid |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c([2H])c(-c4ccc(B(O)O)cc4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C18H13BO2S/c20-19(21)14-8-5-12(6-9-14)13-7-10-16-15-3-1-2-4-17(15)22-18(16)11-13/h1-11,20-21H/i1D,2D,3D,4D,7D,10D,11D |
| InChIKey | UCMZHMIIUQGLJF-YCQFEDOXSA-N |
| XLogP | 3.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|