C43H27N3S — CID 172509598
2-[4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)phenyl]-4-phenyl-6-(7-phenylnaphthalen-1-yl)-1,3,5-triazine (PubChem CID 172509598) has the molecular formula C43H27N3S and a molecular weight of 624.82 g/mol. Its IUPAC name is 2-[4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)phenyl]-4-phenyl-6-(7-phenylnaphthalen-1-yl)-1,3,5-triazine.
| Compound Name | 2-[4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)phenyl]-4-phenyl-6-(7-phenylnaphthalen-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 172509598 |
| Molecular Formula | C43H27N3S |
| Molecular Weight | 624.82 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | 2-[4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)phenyl]-4-phenyl-6-(7-phenylnaphthalen-1-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c([2H])c(-c4ccc(-c5nc(-c6ccccc6)nc(-c6cccc7ccc(-c8ccccc8)cc67)n5)cc4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C43H27N3S/c1-3-10-28(11-4-1)33-23-20-30-14-9-16-37(38(30)26-33)43-45-41(31-12-5-2-6-13-31)44-42(46-43)32-21-18-29(19-22-32)34-24-25-36-35-15-7-8-17-39(35)47-40(36)27-34/h1-27H/i7D,8D,15D,17D,24D,25D,27D |
| InChIKey | NPBVDGAKZNJDNA-PJZFJBDBSA-N |
| XLogP | 11.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.82 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |