C57H35N3S — CID 177107402
2-(1,2,4,6,7,8-hexadeuterio-9-triphenylen-2-yldibenzothiophen-3-yl)-4-(3-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 177107402) has the molecular formula C57H35N3S and a molecular weight of 800.03 g/mol. Its IUPAC name is 2-(1,2,4,6,7,8-hexadeuterio-9-triphenylen-2-yldibenzothiophen-3-yl)-4-(3-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(1,2,4,6,7,8-hexadeuterio-9-triphenylen-2-yldibenzothiophen-3-yl)-4-(3-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 177107402 |
| Molecular Formula | C57H35N3S |
| Molecular Weight | 800.03 g/mol |
| Exact Mass | 799.29 |
| IUPAC Name | 2-(1,2,4,6,7,8-hexadeuterio-9-triphenylen-2-yldibenzothiophen-3-yl)-4-(3-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2ccc3c4ccccc4c4ccccc4c3c2)c2c(sc3c([2H])c(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5cccc(-c6ccccc6)c5)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C57H35N3S/c1-3-13-36(14-4-1)38-25-27-39(28-26-38)55-58-56(42-18-11-17-40(33-42)37-15-5-2-6-16-37)60-57(59-55)43-30-32-50-53(35-43)61-52-24-12-23-44(54(50)52)41-29-31-49-47-21-8-7-19-45(47)46-20-9-10-22-48(46)51(49)34-41/h1-35H/i12D,23D,24D,30D,32D,35D |
| InChIKey | WIHINGOYLSVITM-DCABWROZSA-N |
| XLogP | 15.70 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.03 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|