C63H39N3OS — CID 177107351
2-[1,2,4,6,7,8-hexadeuterio-9-(3,5-diphenylphenyl)dibenzothiophen-3-yl]-4-(7-phenyldibenzofuran-2-yl)-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 177107351) has the molecular formula C63H39N3OS and a molecular weight of 892.13 g/mol. Its IUPAC name is 2-[1,2,4,6,7,8-hexadeuterio-9-(3,5-diphenylphenyl)dibenzothiophen-3-yl]-4-(7-phenyldibenzofuran-2-yl)-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[1,2,4,6,7,8-hexadeuterio-9-(3,5-diphenylphenyl)dibenzothiophen-3-yl]-4-(7-phenyldibenzofuran-2-yl)-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 177107351 |
| Molecular Formula | C63H39N3OS |
| Molecular Weight | 892.13 g/mol |
| Exact Mass | 891.32 |
| IUPAC Name | 2-[1,2,4,6,7,8-hexadeuterio-9-(3,5-diphenylphenyl)dibenzothiophen-3-yl]-4-(7-phenyldibenzofuran-2-yl)-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2c(sc3c([2H])c(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccc6oc7cc(-c8ccccc8)ccc7c6c5)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C63H39N3OS/c1-5-14-40(15-6-1)44-24-26-45(27-25-44)61-64-62(47-30-33-56-55(37-47)53-31-28-46(38-57(53)67-56)41-16-7-2-8-17-41)66-63(65-61)48-29-32-54-59(39-48)68-58-23-13-22-52(60(54)58)51-35-49(42-18-9-3-10-19-42)34-50(36-51)43-20-11-4-12-21-43/h1-39H/i13D,22D,23D,29D,32D,39D |
| InChIKey | QAAVWPUFNARICT-ZJBDIDBJSA-N |
| XLogP | 17.47 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.13 |
| LogP ≤ 5 | 17.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |