C63H41N3S — CID 177107312
2-(3,5-diphenylphenyl)-4-[1,2,4,6,7,8-hexadeuterio-9-(2-phenylphenyl)dibenzothiophen-3-yl]-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 177107312) has the molecular formula C63H41N3S and a molecular weight of 878.15 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-4-[1,2,4,6,7,8-hexadeuterio-9-(2-phenylphenyl)dibenzothiophen-3-yl]-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(3,5-diphenylphenyl)-4-[1,2,4,6,7,8-hexadeuterio-9-(2-phenylphenyl)dibenzothiophen-3-yl]-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 177107312 |
| Molecular Formula | C63H41N3S |
| Molecular Weight | 878.15 g/mol |
| Exact Mass | 877.34 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-4-[1,2,4,6,7,8-hexadeuterio-9-(2-phenylphenyl)dibenzothiophen-3-yl]-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2ccccc2-c2ccccc2)c2c(sc3c([2H])c(-c4nc(-c5ccc(-c6cccc(-c7ccccc7)c6)cc5)nc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C63H41N3S/c1-5-17-42(18-6-1)48-25-15-26-49(37-48)45-31-33-47(34-32-45)61-64-62(66-63(65-61)53-39-51(43-19-7-2-8-20-43)38-52(40-53)44-21-9-3-10-22-44)50-35-36-57-59(41-50)67-58-30-16-29-56(60(57)58)55-28-14-13-27-54(55)46-23-11-4-12-24-46/h1-41H/i16D,29D,30D,35D,36D,41D |
| InChIKey | SIFKFMKPDADNBL-DTEDWVNJSA-N |
| XLogP | 17.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.15 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |