C51H31N3S2 — CID 177107441
2-dibenzothiophen-1-yl-4-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzothiophen-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 177107441) has the molecular formula C51H31N3S2 and a molecular weight of 756.00 g/mol. Its IUPAC name is 2-dibenzothiophen-1-yl-4-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzothiophen-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-1-yl-4-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzothiophen-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 177107441 |
| Molecular Formula | C51H31N3S2 |
| Molecular Weight | 756.00 g/mol |
| Exact Mass | 755.23 |
| IUPAC Name | 2-dibenzothiophen-1-yl-4-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzothiophen-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2ccc(-c3ccccc3)cc2)c2c(sc3c([2H])c(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5cccc6sc7ccccc7c56)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C51H31N3S2/c1-3-11-32(12-4-1)34-21-25-36(26-22-34)39-16-9-19-44-47(39)41-30-29-38(31-46(41)56-44)50-52-49(37-27-23-35(24-28-37)33-13-5-2-6-14-33)53-51(54-50)42-17-10-20-45-48(42)40-15-7-8-18-43(40)55-45/h1-31H/i9D,16D,19D,29D,30D,31D |
| InChIKey | OPNNBGWPPNVXNJ-GGYGUXPXSA-N |
| XLogP | 14.61 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.00 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |