C45H27N3S2 — CID 171057050
2-dibenzothiophen-4-yl-4-(4-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,6,7,8,9-heptadeuteriodibenzothiophen-1-yl)phenyl]-1,3,5-triazine (PubChem CID 171057050) has the molecular formula C45H27N3S2 and a molecular weight of 684.93 g/mol. Its IUPAC name is 2-dibenzothiophen-4-yl-4-(4-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,6,7,8,9-heptadeuteriodibenzothiophen-1-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-4-yl-4-(4-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,6,7,8,9-heptadeuteriodibenzothiophen-1-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 171057050 |
| Molecular Formula | C45H27N3S2 |
| Molecular Weight | 684.93 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | 2-dibenzothiophen-4-yl-4-(4-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,6,7,8,9-heptadeuteriodibenzothiophen-1-yl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2c([2H])c([2H])c([2H])c3sc4c([2H])c([2H])c([2H])c([2H])c4c23)c([2H])c([2H])c1-c1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2cccc3c2sc2ccccc23)n1 |
| InChI | InChI=1S/C45H27N3S2/c1-2-10-28(11-3-1)29-20-24-31(25-21-29)43-46-44(48-45(47-43)37-16-8-15-35-34-12-4-6-17-38(34)50-42(35)37)32-26-22-30(23-27-32)33-14-9-19-40-41(33)36-13-5-7-18-39(36)49-40/h1-27H/i5D,7D,9D,13D,14D,18D,19D,22D,23D,26D,27D |
| InChIKey | LGOVYVLYMBSFED-GGLXWHATSA-N |
| XLogP | 12.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.93 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |