C45H27N3S2 — CID 169279960
2-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-4-(2,3,4,6,7,8,9-heptadeuteriodibenzothiophen-1-yl)-6-[2-(4-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 169279960) has the molecular formula C45H27N3S2 and a molecular weight of 687.95 g/mol. Its IUPAC name is 2-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-4-(2,3,4,6,7,8,9-heptadeuteriodibenzothiophen-1-yl)-6-[2-(4-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-4-(2,3,4,6,7,8,9-heptadeuteriodibenzothiophen-1-yl)-6-[2-(4-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 169279960 |
| Molecular Formula | C45H27N3S2 |
| Molecular Weight | 687.95 g/mol |
| Exact Mass | 687.25 |
| IUPAC Name | 2-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-4-(2,3,4,6,7,8,9-heptadeuteriodibenzothiophen-1-yl)-6-[2-(4-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c(-c4nc(-c5ccccc5-c5ccc(-c6ccccc6)cc5)nc(-c5c([2H])c([2H])c([2H])c6sc7c([2H])c([2H])c([2H])c([2H])c7c56)n4)c([2H])c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C45H27N3S2/c1-2-12-28(13-3-1)29-24-26-30(27-25-29)31-14-4-5-16-34(31)43-46-44(36-19-11-23-40-41(36)35-17-7-9-22-39(35)49-40)48-45(47-43)37-20-10-18-33-32-15-6-8-21-38(32)50-42(33)37/h1-27H/i6D,7D,8D,9D,10D,11D,15D,17D,18D,19D,20D,21D,22D,23D |
| InChIKey | BUWMZLRQSUHVSH-QFKFOERMSA-N |
| XLogP | 12.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.95 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |