C45H27N3S2 — CID 169280077
2-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 169280077) has the molecular formula C45H27N3S2 and a molecular weight of 687.95 g/mol. Its IUPAC name is 2-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 169280077 |
| Molecular Formula | C45H27N3S2 |
| Molecular Weight | 687.95 g/mol |
| Exact Mass | 687.25 |
| IUPAC Name | 2-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)-4-(1,3,4,6,7,8,9-heptadeuteriodibenzothiophen-2-yl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c([2H])c([2H])c(-c4nc(-c5ccc(-c6cccc(-c7ccccc7)c6)cc5)nc(-c5c([2H])c([2H])c([2H])c6c5sc5c([2H])c([2H])c([2H])c([2H])c56)n4)c([2H])c32)c1[2H] |
| InChI | InChI=1S/C45H27N3S2/c1-2-10-28(11-3-1)31-12-8-13-32(26-31)29-20-22-30(23-21-29)43-46-44(33-24-25-41-38(27-33)35-15-5-6-18-39(35)49-41)48-45(47-43)37-17-9-16-36-34-14-4-7-19-40(34)50-42(36)37/h1-27H/i4D,5D,6D,7D,9D,14D,15D,16D,17D,18D,19D,24D,25D,27D |
| InChIKey | KJYCOSHBTILZHU-WMFKDMGGSA-N |
| XLogP | 12.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.95 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |