C49H31N3S — CID 177107069
2-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]-4-(4-naphthalen-1-ylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 177107069) has the molecular formula C49H31N3S and a molecular weight of 704.94 g/mol. Its IUPAC name is 2-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]-4-(4-naphthalen-1-ylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]-4-(4-naphthalen-1-ylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 177107069 |
| Molecular Formula | C49H31N3S |
| Molecular Weight | 704.94 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | 2-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]-4-(4-naphthalen-1-ylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c3sc4c([2H])c(-c5nc(-c6ccc(-c7ccccc7)cc6)nc(-c6ccc(-c7cccc8ccccc78)cc6)n5)c([2H])c([2H])c4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C49H31N3S/c1-3-11-32(12-4-1)33-21-25-37(26-22-33)47-50-48(38-27-23-36(24-28-38)41-18-9-16-34-15-7-8-17-40(34)41)52-49(51-47)39-29-30-43-45(31-39)53-44-20-10-19-42(46(43)44)35-13-5-2-6-14-35/h1-31H/i2D,5D,6D,10D,13D,14D,19D,20D,29D,30D,31D |
| InChIKey | NFNXJTIPAUTACJ-XDNNYNPQSA-N |
| XLogP | 13.39 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.94 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |