C41H27N3S2 — CID 177107100
2-[4-(2,3-dihydro-1-benzothiophen-3-yl)phenyl]-4-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]-6-phenyl-1,3,5-triazine (PubChem CID 177107100) has the molecular formula C41H27N3S2 and a molecular weight of 636.89 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1-benzothiophen-3-yl)phenyl]-4-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-(2,3-dihydro-1-benzothiophen-3-yl)phenyl]-4-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 177107100 |
| Molecular Formula | C41H27N3S2 |
| Molecular Weight | 636.89 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | 2-[4-(2,3-dihydro-1-benzothiophen-3-yl)phenyl]-4-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-3-yl]-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c3sc4c([2H])c(-c5nc(-c6ccccc6)nc(-c6ccc(C7CSc8ccccc87)cc6)n5)c([2H])c([2H])c4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C41H27N3S2/c1-3-10-26(11-4-1)31-15-9-17-36-38(31)33-23-22-30(24-37(33)46-36)41-43-39(28-12-5-2-6-13-28)42-40(44-41)29-20-18-27(19-21-29)34-25-45-35-16-8-7-14-32(34)35/h1-24,34H,25H2/i1D,3D,4D,9D,10D,11D,15D,17D,22D,23D,24D |
| InChIKey | DDXBAIKYTBBTIS-FLPBZGPLSA-N |
| XLogP | 11.15 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.89 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |