C57H35N3OS — CID 177107430
2-(2-dibenzofuran-3-ylphenyl)-4-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzothiophen-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 177107430) has the molecular formula C57H35N3OS and a molecular weight of 816.03 g/mol. Its IUPAC name is 2-(2-dibenzofuran-3-ylphenyl)-4-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzothiophen-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(2-dibenzofuran-3-ylphenyl)-4-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzothiophen-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 177107430 |
| Molecular Formula | C57H35N3OS |
| Molecular Weight | 816.03 g/mol |
| Exact Mass | 815.29 |
| IUPAC Name | 2-(2-dibenzofuran-3-ylphenyl)-4-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzothiophen-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2ccc(-c3ccccc3)cc2)c2c(sc3c([2H])c(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccccc5-c5ccc6c(c5)oc5ccccc56)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C57H35N3OS/c1-3-12-36(13-4-1)38-22-26-40(27-23-38)45-19-11-21-52-54(45)49-33-31-43(35-53(49)62-52)56-58-55(41-28-24-39(25-29-41)37-14-5-2-6-15-37)59-57(60-56)48-18-8-7-16-44(48)42-30-32-47-46-17-9-10-20-50(46)61-51(47)34-42/h1-35H/i11D,19D,21D,31D,33D,35D |
| InChIKey | MVJZAVYFDHPPPB-WWJUEVLWSA-N |
| XLogP | 15.81 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.03 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |