C58H37N3S — CID 177107232
2-(9,9-diphenylfluoren-2-yl)-4-(1,2,4,6,7,8-hexadeuterio-9-phenyldibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 177107232) has the molecular formula C58H37N3S and a molecular weight of 814.06 g/mol. Its IUPAC name is 2-(9,9-diphenylfluoren-2-yl)-4-(1,2,4,6,7,8-hexadeuterio-9-phenyldibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(9,9-diphenylfluoren-2-yl)-4-(1,2,4,6,7,8-hexadeuterio-9-phenyldibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 177107232 |
| Molecular Formula | C58H37N3S |
| Molecular Weight | 814.06 g/mol |
| Exact Mass | 813.31 |
| IUPAC Name | 2-(9,9-diphenylfluoren-2-yl)-4-(1,2,4,6,7,8-hexadeuterio-9-phenyldibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2ccccc2)c2c(sc3c([2H])c(-c4nc(-c5cccc(-c6ccccc6)c5)nc(-c5ccc6c(c5)C(c5ccccc5)(c5ccccc5)c5ccccc5-6)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C58H37N3S/c1-5-17-38(18-6-1)40-21-15-22-41(35-40)55-59-56(61-57(60-55)43-32-34-49-53(37-43)62-52-30-16-28-46(54(49)52)39-19-7-2-8-20-39)42-31-33-48-47-27-13-14-29-50(47)58(51(48)36-42,44-23-9-3-10-24-44)45-25-11-4-12-26-45/h1-37H/i16D,28D,30D,32D,34D,37D |
| InChIKey | DCWUEKDGPBRGIZ-CPYDPSOPSA-N |
| XLogP | 14.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.06 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |