C45H27N3OS — CID 177107273
2-dibenzothiophen-3-yl-4-[1,2,4,6,7,8-hexadeuterio-9-(3-phenylphenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazine (PubChem CID 177107273) has the molecular formula C45H27N3OS and a molecular weight of 663.83 g/mol. Its IUPAC name is 2-dibenzothiophen-3-yl-4-[1,2,4,6,7,8-hexadeuterio-9-(3-phenylphenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-3-yl-4-[1,2,4,6,7,8-hexadeuterio-9-(3-phenylphenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 177107273 |
| Molecular Formula | C45H27N3OS |
| Molecular Weight | 663.83 g/mol |
| Exact Mass | 663.23 |
| IUPAC Name | 2-dibenzothiophen-3-yl-4-[1,2,4,6,7,8-hexadeuterio-9-(3-phenylphenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2cccc(-c3ccccc3)c2)c2c(oc3c([2H])c(-c4nc(-c5ccccc5)nc(-c5ccc6c(c5)sc5ccccc56)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C45H27N3OS/c1-3-11-28(12-4-1)30-15-9-16-31(25-30)34-18-10-19-38-42(34)37-24-22-32(26-39(37)49-38)44-46-43(29-13-5-2-6-14-29)47-45(48-44)33-21-23-36-35-17-7-8-20-40(35)50-41(36)27-33/h1-27H/i10D,18D,19D,22D,24D,26D |
| InChIKey | KJMGGTJOFUTUFA-YOESENNYSA-N |
| XLogP | 12.47 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.83 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |