C57H35N3O2 — CID 177107360
2-dibenzofuran-1-yl-4-(3,5-diphenylphenyl)-6-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine (PubChem CID 177107360) has the molecular formula C57H35N3O2 and a molecular weight of 799.96 g/mol. Its IUPAC name is 2-dibenzofuran-1-yl-4-(3,5-diphenylphenyl)-6-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-1-yl-4-(3,5-diphenylphenyl)-6-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 177107360 |
| Molecular Formula | C57H35N3O2 |
| Molecular Weight | 799.96 g/mol |
| Exact Mass | 799.31 |
| IUPAC Name | 2-dibenzofuran-1-yl-4-(3,5-diphenylphenyl)-6-[1,2,4,6,7,8-hexadeuterio-9-(4-phenylphenyl)dibenzofuran-3-yl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2ccc(-c3ccccc3)cc2)c2c(oc3c([2H])c(-c4nc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)nc(-c5cccc6oc7ccccc7c56)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C57H35N3O2/c1-4-14-36(15-5-1)39-26-28-40(29-27-39)45-21-12-24-50-53(45)47-31-30-41(35-52(47)62-50)55-58-56(60-57(59-55)48-22-13-25-51-54(48)46-20-10-11-23-49(46)61-51)44-33-42(37-16-6-2-7-17-37)32-43(34-44)38-18-8-3-9-19-38/h1-35H/i12D,21D,24D,30D,31D,35D |
| InChIKey | FJGFJXHBQMSLGZ-YRZIBWPTSA-N |
| XLogP | 15.34 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.96 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |