C45H26N4OS — CID 164932849
5-[4-(1,2,4,6,7,8-hexadeuterio-9-phenyldibenzofuran-3-yl)-6-phenyl-1,3,5-triazin-2-yl]-[1]benzothiolo[3,2-c]carbazole (PubChem CID 164932849) has the molecular formula C45H26N4OS and a molecular weight of 676.83 g/mol. Its IUPAC name is 5-[4-(1,2,4,6,7,8-hexadeuterio-9-phenyldibenzofuran-3-yl)-6-phenyl-1,3,5-triazin-2-yl]-[1]benzothiolo[3,2-c]carbazole.
| Compound Name | 5-[4-(1,2,4,6,7,8-hexadeuterio-9-phenyldibenzofuran-3-yl)-6-phenyl-1,3,5-triazin-2-yl]-[1]benzothiolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 164932849 |
| Molecular Formula | C45H26N4OS |
| Molecular Weight | 676.83 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | 5-[4-(1,2,4,6,7,8-hexadeuterio-9-phenyldibenzofuran-3-yl)-6-phenyl-1,3,5-triazin-2-yl]-[1]benzothiolo[3,2-c]carbazole |
| SMILES | [2H]c1c([2H])c(-c2ccccc2)c2c(oc3c([2H])c(-c4nc(-c5ccccc5)nc(-n5c6ccccc6c6c7sc8ccccc8c7ccc65)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C45H26N4OS/c1-3-12-27(13-4-1)30-18-11-20-37-40(30)34-23-22-29(26-38(34)50-37)44-46-43(28-14-5-2-6-15-28)47-45(48-44)49-35-19-9-7-17-33(35)41-36(49)25-24-32-31-16-8-10-21-39(31)51-42(32)41/h1-26H/i11D,18D,20D,22D,23D,26D |
| InChIKey | ZUZUBGWJCKJIJT-IHFVCQMWSA-N |
| XLogP | 12.24 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.83 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |