C31H18ClN3S — CID 177278909
2-chloro-4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)-6-(7-phenylnaphthalen-2-yl)-1,3,5-triazine (PubChem CID 177278909) has the molecular formula C31H18ClN3S and a molecular weight of 507.07 g/mol. Its IUPAC name is 2-chloro-4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)-6-(7-phenylnaphthalen-2-yl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)-6-(7-phenylnaphthalen-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 177278909 |
| Molecular Formula | C31H18ClN3S |
| Molecular Weight | 507.07 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 2-chloro-4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)-6-(7-phenylnaphthalen-2-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c([2H])c(-c4nc(Cl)nc(-c5ccc6ccc(-c7ccccc7)cc6c5)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C31H18ClN3S/c32-31-34-29(22-13-11-20-10-12-21(16-24(20)17-22)19-6-2-1-3-7-19)33-30(35-31)23-14-15-26-25-8-4-5-9-27(25)36-28(26)18-23/h1-18H/i4D,5D,8D,9D,14D,15D,18D |
| InChIKey | GPGFOZGGRTWIRA-LSDCVDJYSA-N |
| XLogP | 9.05 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.07 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |