C55H33N3S2 — CID 171430881
2-[3-(1,2,3,4,5,6,7,8,10-nonadeuterionaphtho[1,2-b][1]benzothiol-9-yl)phenyl]-4-(9-phenyldibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 171430881) has the molecular formula C55H33N3S2 and a molecular weight of 809.08 g/mol. Its IUPAC name is 2-[3-(1,2,3,4,5,6,7,8,10-nonadeuterionaphtho[1,2-b][1]benzothiol-9-yl)phenyl]-4-(9-phenyldibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-(1,2,3,4,5,6,7,8,10-nonadeuterionaphtho[1,2-b][1]benzothiol-9-yl)phenyl]-4-(9-phenyldibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171430881 |
| Molecular Formula | C55H33N3S2 |
| Molecular Weight | 809.08 g/mol |
| Exact Mass | 808.27 |
| IUPAC Name | 2-[3-(1,2,3,4,5,6,7,8,10-nonadeuterionaphtho[1,2-b][1]benzothiol-9-yl)phenyl]-4-(9-phenyldibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c([2H])c1c2sc2c([2H])c(-c3cccc(-c4nc(-c5cccc(-c6ccccc6)c5)nc(-c5ccc6c(c5)sc5cccc(-c7ccccc7)c56)n4)c3)c([2H])c([2H])c21 |
| InChI | InChI=1S/C55H33N3S2/c1-3-12-34(13-4-1)37-17-9-19-40(30-37)53-56-54(58-55(57-53)42-26-29-47-50(33-42)59-48-23-11-22-43(51(47)48)35-14-5-2-6-15-35)41-20-10-18-38(31-41)39-25-27-45-46-28-24-36-16-7-8-21-44(36)52(46)60-49(45)32-39/h1-33H/i7D,8D,16D,21D,24D,25D,27D,28D,32D |
| InChIKey | NDSWQBWRQHDBOL-YCVQETTCSA-N |
| XLogP | 15.76 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.08 |
| LogP ≤ 5 | 15.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |