C49H29N3OS — CID 171430770
2-[3-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzofuran-7-yl)phenyl]-4-phenyl-6-(9-phenyldibenzothiophen-3-yl)-1,3,5-triazine (PubChem CID 171430770) has the molecular formula C49H29N3OS and a molecular weight of 716.91 g/mol. Its IUPAC name is 2-[3-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzofuran-7-yl)phenyl]-4-phenyl-6-(9-phenyldibenzothiophen-3-yl)-1,3,5-triazine.
| Compound Name | 2-[3-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzofuran-7-yl)phenyl]-4-phenyl-6-(9-phenyldibenzothiophen-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171430770 |
| Molecular Formula | C49H29N3OS |
| Molecular Weight | 716.91 g/mol |
| Exact Mass | 716.26 |
| IUPAC Name | 2-[3-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzofuran-7-yl)phenyl]-4-phenyl-6-(9-phenyldibenzothiophen-3-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)sc4cccc(-c6ccccc6)c45)n3)c2)c2c(oc3c4c([2H])c([2H])c([2H])c([2H])c4c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C49H29N3OS/c1-3-12-30(13-4-1)36-21-11-23-42-45(36)39-26-25-35(29-43(39)54-42)49-51-47(32-15-5-2-6-16-32)50-48(52-49)34-18-9-17-33(28-34)37-20-10-22-41-44(37)40-27-24-31-14-7-8-19-38(31)46(40)53-41/h1-29H/i7D,8D,10D,14D,19D,20D,22D,24D,27D |
| InChIKey | JIFZFGPNSHSFHT-SCMMDYFCSA-N |
| XLogP | 13.63 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.91 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |