C43H26ClN3S — CID 168845137
2-chloro-4-[3-(1,3,4,5,6,7-hexadeuterio-8-phenylnaphthalen-2-yl)phenyl]-6-(9-phenyldibenzothiophen-2-yl)-1,3,5-triazine (PubChem CID 168845137) has the molecular formula C43H26ClN3S and a molecular weight of 658.26 g/mol. Its IUPAC name is 2-chloro-4-[3-(1,3,4,5,6,7-hexadeuterio-8-phenylnaphthalen-2-yl)phenyl]-6-(9-phenyldibenzothiophen-2-yl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-[3-(1,3,4,5,6,7-hexadeuterio-8-phenylnaphthalen-2-yl)phenyl]-6-(9-phenyldibenzothiophen-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168845137 |
| Molecular Formula | C43H26ClN3S |
| Molecular Weight | 658.26 g/mol |
| Exact Mass | 657.19 |
| IUPAC Name | 2-chloro-4-[3-(1,3,4,5,6,7-hexadeuterio-8-phenylnaphthalen-2-yl)phenyl]-6-(9-phenyldibenzothiophen-2-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2ccccc2)c2c([2H])c(-c3cccc(-c4nc(Cl)nc(-c5ccc6sc7cccc(-c8ccccc8)c7c6c5)n4)c3)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C43H26ClN3S/c44-43-46-41(32-16-7-15-30(24-32)31-21-20-29-14-8-17-34(36(29)25-31)27-10-3-1-4-11-27)45-42(47-43)33-22-23-38-37(26-33)40-35(18-9-19-39(40)48-38)28-12-5-2-6-13-28/h1-26H/i8D,14D,17D,20D,21D,25D |
| InChIKey | FXYOZRUQPGEFTK-ILJPVFJOSA-N |
| XLogP | 12.38 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.26 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |