C38H22S2 — CID 156624986
1,2,3,4,6,8,9-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,6,7,8,9-hexadeuteriodibenzothiophen-4-yl)anthracen-9-yl]dibenzothiophene (PubChem CID 156624986) has the molecular formula C38H22S2 and a molecular weight of 563.86 g/mol. Its IUPAC name is 1,2,3,4,6,8,9-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,6,7,8,9-hexadeuteriodibenzothiophen-4-yl)anthracen-9-yl]dibenzothiophene.
| Compound Name | 1,2,3,4,6,8,9-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,6,7,8,9-hexadeuteriodibenzothiophen-4-yl)anthracen-9-yl]dibenzothiophene |
|---|---|
| PubChem CID | 156624986 |
| Molecular Formula | C38H22S2 |
| Molecular Weight | 563.86 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 1,2,3,4,6,8,9-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,6,7,8,9-hexadeuteriodibenzothiophen-4-yl)anthracen-9-yl]dibenzothiophene |
| SMILES | [2H]c1cc2c(sc3c([2H])c([2H])c([2H])c([2H])c32)c(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3c([2H])c([2H])c4c(sc5c([2H])c([2H])c([2H])c([2H])c54)c3[2H])c3c([2H])c([2H])c([2H])c([2H])c23)c1[2H] |
| InChI | InChI=1S/C38H22S2/c1-3-14-29-27(12-1)36(23-20-21-26-24-10-5-7-18-33(24)39-35(26)22-23)28-13-2-4-15-30(28)37(29)32-17-9-16-31-25-11-6-8-19-34(25)40-38(31)32/h1-22H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,17D,18D,19D,20D,21D,22D |
| InChIKey | ZXXLBIMNFKOQSF-XYHDPVQASA-N |
| XLogP | 12.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.86 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|