C31H20S — CID 167632401
1,2,3,4,7,8-hexadeuterio-9-methyl-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)dibenzothiophene (PubChem CID 167632401) has the molecular formula C31H20S and a molecular weight of 441.67 g/mol. Its IUPAC name is 1,2,3,4,7,8-hexadeuterio-9-methyl-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)dibenzothiophene.
| Compound Name | 1,2,3,4,7,8-hexadeuterio-9-methyl-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)dibenzothiophene |
|---|---|
| PubChem CID | 167632401 |
| Molecular Formula | C31H20S |
| Molecular Weight | 441.67 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 1,2,3,4,7,8-hexadeuterio-9-methyl-6-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)dibenzothiophene |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c(-c4c([2H])c([2H])c5c6c([2H])c([2H])c([2H])c([2H])c6c6c([2H])c([2H])c([2H])c([2H])c6c5c4[2H])c([2H])c([2H])c(C)c32)c1[2H] |
| InChI | InChI=1S/C31H20S/c1-19-14-16-21(31-30(19)27-12-6-7-13-29(27)32-31)20-15-17-26-24-10-3-2-8-22(24)23-9-4-5-11-25(23)28(26)18-20/h2-18H,1H3/i2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D,18D |
| InChIKey | PXUQXSKAMDAQPG-FBCOPPILSA-N |
| XLogP | 9.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.67 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|