C36H22S — CID 166047006
1,2,3,4,7,8,9-heptadeuterio-6-(3-triphenylen-2-ylphenyl)dibenzothiophene (PubChem CID 166047006) has the molecular formula C36H22S and a molecular weight of 493.68 g/mol. Its IUPAC name is 1,2,3,4,7,8,9-heptadeuterio-6-(3-triphenylen-2-ylphenyl)dibenzothiophene.
| Compound Name | 1,2,3,4,7,8,9-heptadeuterio-6-(3-triphenylen-2-ylphenyl)dibenzothiophene |
|---|---|
| PubChem CID | 166047006 |
| Molecular Formula | C36H22S |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 1,2,3,4,7,8,9-heptadeuterio-6-(3-triphenylen-2-ylphenyl)dibenzothiophene |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c(-c4cccc(-c5ccc6c7ccccc7c7ccccc7c6c5)c4)c([2H])c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C36H22S/c1-2-13-29-27(11-1)28-12-3-4-14-30(28)34-22-24(19-20-31(29)34)23-9-7-10-25(21-23)26-16-8-17-33-32-15-5-6-18-35(32)37-36(26)33/h1-22H/i5D,6D,8D,15D,16D,17D,18D |
| InChIKey | QKVWPNRUXZYLQV-QIYJHOJJSA-N |
| XLogP | 10.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|