C39H23N3OS — CID 168748857
2-dibenzofuran-3-yl-4-phenyl-6-[2,3,5,6-tetradeuterio-4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)phenyl]-1,3,5-triazine (PubChem CID 168748857) has the molecular formula C39H23N3OS and a molecular weight of 592.77 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-phenyl-6-[2,3,5,6-tetradeuterio-4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-phenyl-6-[2,3,5,6-tetradeuterio-4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 168748857 |
| Molecular Formula | C39H23N3OS |
| Molecular Weight | 592.77 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-phenyl-6-[2,3,5,6-tetradeuterio-4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2c([2H])c([2H])c([2H])c3c2sc2c([2H])c([2H])c([2H])c([2H])c23)c([2H])c([2H])c1-c1nc(-c2ccccc2)nc(-c2ccc3c(c2)oc2ccccc23)n1 |
| InChI | InChI=1S/C39H23N3OS/c1-2-9-25(10-3-1)37-40-38(42-39(41-37)27-21-22-30-29-11-4-6-15-33(29)43-34(30)23-27)26-19-17-24(18-20-26)28-13-8-14-32-31-12-5-7-16-35(31)44-36(28)32/h1-23H/i5D,7D,8D,12D,13D,14D,16D,17D,18D,19D,20D |
| InChIKey | JNHNINYHKLJNNZ-RJLHPRFFSA-N |
| XLogP | 10.81 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.77 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |