C30H18S — CID 175911585
2-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)dibenzothiophene (PubChem CID 175911585) has the molecular formula C30H18S and a molecular weight of 421.61 g/mol. Its IUPAC name is 2-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)dibenzothiophene.
| Compound Name | 2-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)dibenzothiophene |
|---|---|
| PubChem CID | 175911585 |
| Molecular Formula | C30H18S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-(1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylen-2-yl)dibenzothiophene |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1c1c([2H])c(-c3ccc4sc5ccccc5c4c3)c([2H])c([2H])c21 |
| InChI | InChI=1S/C30H18S/c1-2-9-23-21(7-1)22-8-3-4-10-24(22)27-17-19(13-15-25(23)27)20-14-16-30-28(18-20)26-11-5-6-12-29(26)31-30/h1-18H/i1D,2D,3D,4D,7D,8D,9D,10D,13D,15D,17D |
| InChIKey | RKKMJGRISKLVJJ-WGCOSVKLSA-N |
| XLogP | 9.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|