C42H26 — CID 166046962
2-[3-(3,4,5,6,7,8,9,10,11,12-decadeuteriotriphenylen-2-yl)phenyl]-1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylene (PubChem CID 166046962) has the molecular formula C42H26 and a molecular weight of 551.80 g/mol. Its IUPAC name is 2-[3-(3,4,5,6,7,8,9,10,11,12-decadeuteriotriphenylen-2-yl)phenyl]-1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylene.
| Compound Name | 2-[3-(3,4,5,6,7,8,9,10,11,12-decadeuteriotriphenylen-2-yl)phenyl]-1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylene |
|---|---|
| PubChem CID | 166046962 |
| Molecular Formula | C42H26 |
| Molecular Weight | 551.80 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | 2-[3-(3,4,5,6,7,8,9,10,11,12-decadeuteriotriphenylen-2-yl)phenyl]-1,3,4,5,6,7,8,9,10,11,12-undecadeuteriotriphenylene |
| SMILES | [2H]c1c(-c2cccc(-c3c([2H])c([2H])c4c5c([2H])c([2H])c([2H])c([2H])c5c5c([2H])c([2H])c([2H])c([2H])c5c4c3[2H])c2)cc2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1c1c([2H])c([2H])c([2H])c([2H])c21 |
| InChI | InChI=1S/C42H26/c1-3-16-35-31(12-1)33-14-5-7-18-37(33)41-25-29(20-22-39(35)41)27-10-9-11-28(24-27)30-21-23-40-36-17-4-2-13-32(36)34-15-6-8-19-38(34)42(40)26-30/h1-26H/i1D,2D,3D,4D,5D,6D,7D,8D,12D,13D,14D,15D,16D,17D,18D,19D,20D,21D,22D,23D,25D |
| InChIKey | FEEVDOPOKYHDKB-HYZAYFHHSA-N |
| XLogP | 11.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.80 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|