C17H13NS — CID 154587787
3,4,5,6-tetradeuterio-2-(1,4,6,7,8,9-hexadeuteriodibenzothiophen-3-yl)-3,4-dihydropyridine (PubChem CID 154587787) has the molecular formula C17H13NS and a molecular weight of 273.43 g/mol. Its IUPAC name is 3,4,5,6-tetradeuterio-2-(1,4,6,7,8,9-hexadeuteriodibenzothiophen-3-yl)-3,4-dihydropyridine.
| Compound Name | 3,4,5,6-tetradeuterio-2-(1,4,6,7,8,9-hexadeuteriodibenzothiophen-3-yl)-3,4-dihydropyridine |
|---|---|
| PubChem CID | 154587787 |
| Molecular Formula | C17H13NS |
| Molecular Weight | 273.43 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 3,4,5,6-tetradeuterio-2-(1,4,6,7,8,9-hexadeuteriodibenzothiophen-3-yl)-3,4-dihydropyridine |
| SMILES | [2H]C1=C([2H])C([2H])C([2H])C(c2cc([2H])c3c(sc4c([2H])c([2H])c([2H])c([2H])c43)c2[2H])=N1 |
| InChI | InChI=1S/C17H13NS/c1-2-7-16-13(5-1)14-9-8-12(11-17(14)19-16)15-6-3-4-10-18-15/h1-2,4-5,7-11H,3,6H2/i1D,2D,3D,4D,5D,6D,7D,9D,10D,11D |
| InChIKey | MWMPGYMEOVNGAZ-DOECWUFHSA-N |
| XLogP | 5.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |