C12H8Br2 — CID 170663253
1,2,3,4,5-pentadeuterio-6-(3,5-dibromo-2,4,6-trideuteriophenyl)benzene (PubChem CID 170663253) has the molecular formula C12H8Br2 and a molecular weight of 320.05 g/mol. Its IUPAC name is 1,2,3,4,5-pentadeuterio-6-(3,5-dibromo-2,4,6-trideuteriophenyl)benzene.
| Compound Name | 1,2,3,4,5-pentadeuterio-6-(3,5-dibromo-2,4,6-trideuteriophenyl)benzene |
|---|---|
| PubChem CID | 170663253 |
| Molecular Formula | C12H8Br2 |
| Molecular Weight | 320.05 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(3,5-dibromo-2,4,6-trideuteriophenyl)benzene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c(Br)c([2H])c(Br)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C12H8Br2/c13-11-6-10(7-12(14)8-11)9-4-2-1-3-5-9/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| InChIKey | HIHYAKDOWUFGBK-PGRXLJNUSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.05 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |