C18H12Br2 — CID 163546389
1-bromo-4-[4-(4-bromo-2,3,5,6-tetradeuteriophenyl)phenyl]-2,3,5,6-tetradeuteriobenzene (PubChem CID 163546389) has the molecular formula C18H12Br2 and a molecular weight of 396.15 g/mol. Its IUPAC name is 1-bromo-4-[4-(4-bromo-2,3,5,6-tetradeuteriophenyl)phenyl]-2,3,5,6-tetradeuteriobenzene.
| Compound Name | 1-bromo-4-[4-(4-bromo-2,3,5,6-tetradeuteriophenyl)phenyl]-2,3,5,6-tetradeuteriobenzene |
|---|---|
| PubChem CID | 163546389 |
| Molecular Formula | C18H12Br2 |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 1-bromo-4-[4-(4-bromo-2,3,5,6-tetradeuteriophenyl)phenyl]-2,3,5,6-tetradeuteriobenzene |
| SMILES | [2H]c1c([2H])c(-c2ccc(-c3c([2H])c([2H])c(Br)c([2H])c3[2H])cc2)c([2H])c([2H])c1Br |
| InChI | InChI=1S/C18H12Br2/c19-17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(20)12-8-16/h1-12H/i5D,6D,7D,8D,9D,10D,11D,12D |
| InChIKey | VAIPJQIPFPRJKJ-OIIWATDQSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |