C18H11BrS — CID 164761186
3-(4-bromo-2,3,5,6-tetradeuteriophenyl)dibenzothiophene (PubChem CID 164761186) has the molecular formula C18H11BrS and a molecular weight of 343.28 g/mol. Its IUPAC name is 3-(4-bromo-2,3,5,6-tetradeuteriophenyl)dibenzothiophene.
| Compound Name | 3-(4-bromo-2,3,5,6-tetradeuteriophenyl)dibenzothiophene |
|---|---|
| PubChem CID | 164761186 |
| Molecular Formula | C18H11BrS |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 3-(4-bromo-2,3,5,6-tetradeuteriophenyl)dibenzothiophene |
| SMILES | [2H]c1c([2H])c(-c2ccc3c(c2)sc2ccccc23)c([2H])c([2H])c1Br |
| InChI | InChI=1S/C18H11BrS/c19-14-8-5-12(6-9-14)13-7-10-16-15-3-1-2-4-17(15)20-18(16)11-13/h1-11H/i5D,6D,8D,9D |
| InChIKey | UTOWTOOIQBQHPE-PKHQNOSGSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |