C20H13Br — CID 164958779
2-bromo-1,3,4,5,7,8-hexadeuterio-6-naphthalen-2-ylnaphthalene (PubChem CID 164958779) has the molecular formula C20H13Br and a molecular weight of 339.26 g/mol. Its IUPAC name is 2-bromo-1,3,4,5,7,8-hexadeuterio-6-naphthalen-2-ylnaphthalene.
| Compound Name | 2-bromo-1,3,4,5,7,8-hexadeuterio-6-naphthalen-2-ylnaphthalene |
|---|---|
| PubChem CID | 164958779 |
| Molecular Formula | C20H13Br |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-bromo-1,3,4,5,7,8-hexadeuterio-6-naphthalen-2-ylnaphthalene |
| SMILES | [2H]c1c(-c2ccc3ccccc3c2)c([2H])c2c([2H])c([2H])c(Br)c([2H])c2c1[2H] |
| InChI | InChI=1S/C20H13Br/c21-20-10-9-18-12-17(7-8-19(18)13-20)16-6-5-14-3-1-2-4-15(14)11-16/h1-13H/i7D,8D,9D,10D,12D,13D |
| InChIKey | BPSRUMBGSVISHE-ZDGOMMNVSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |